Compound Q&A

What are the physical and chemical properties of 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

Answer

12H-[1]Benzothieno[2,3-a]carbazole
12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is a crystalline compound with a molecular weight of approximately 316.23 g/mol. It has poor water solubility but is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). The compound is known for its high reactivity under certain conditions, particularly in the presence of strong acids or bases. It exhibits excellent stability under normal storage conditions but can degrade upon exposure to air and light.

About

CAS No 222-21-9
English Name 12H-[1]Benzothieno[2,3-a]carbazole
Molecular Formula C18H11NS
Molecular Weight 273.36 g/mol
SMILES N1C2=C(C=CC=C2)C2=C1C1=C(C=C2)C2=C(S1)C=CC=C2
InChIKey CILATXQQOGDBRQ-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) typically synthesized?

12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is typically synthesized through a multi-step pro...

Compound Q&A

What industries use 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is widely used in the semiconductor industry for ...

Compound Q&A

What precautions should be taken when handling 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

When handling 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...