Compound Q&A

What industries use (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

Answer

(2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid
This compound is used in the pharmaceutical industry for the synthesis of certain biologically active molecules. It is also applied in the polymer industry for the modification of polymer surfaces. Additionally, it has potential applications in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid
Molecular Formula C14H25NO4
Molecular Weight 271.36 g/mol
SMILES CC(C)(C)OC(=O)N[C@H](CCCCCC=C)C(=O)O
InChIKey ZVCMWNFQYIQWSY-LLVKDONJSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

The compound exhibits a crystalline form at room temperature. Its molecular weight is approximately ...

Compound Q&A

How is (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7) typically synthesized?

This compound can be synthesized via a multi-step process involving the esterification of 8-nonenoic...

Compound Q&A

What precautions should be taken when handling (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

When handling this compound, it is advisable to use gloves and lab coats to protect against skin con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...