Compound Q&A

What are the physical and chemical properties of (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

Answer

(2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid
The compound exhibits a crystalline form at room temperature. Its molecular weight is approximately 270.34 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It is a moderately reactive acid, showing typical carboxylic acid properties.

About

English Name (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid
Molecular Formula C14H25NO4
Molecular Weight 271.36 g/mol
SMILES CC(C)(C)OC(=O)N[C@H](CCCCCC=C)C(=O)O
InChIKey ZVCMWNFQYIQWSY-LLVKDONJSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7) typically synthesized?

This compound can be synthesized via a multi-step process involving the esterification of 8-nonenoic...

Compound Q&A

What industries use (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

This compound is used in the pharmaceutical industry for the synthesis of certain biologically activ...

Compound Q&A

What precautions should be taken when handling (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-8-nonenoic acid (CAS: 881683-84-7)?

When handling this compound, it is advisable to use gloves and lab coats to protect against skin con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...