Compound Q&A

What are the physical and chemical properties of 2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2)?

Answer

2,4,6-Trimethylbenzenesulfonamide
2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2) is a white crystalline solid with a molecular weight of approximately 218.25 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is stable under normal conditions but can undergo sulfonation reactions. It is used in various applications due to its stability and reactivity.

About

CAS No 4543-58-2
English Name 2,4,6-Trimethylbenzenesulfonamide
Molecular Formula C9H13NO2S
Molecular Weight 199.27 g/mol
SMILES Cc1cc(C)c(c(C)c1)S(=O)(=O)N
InChIKey YECJUZIGFPJWGQ-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2) typically synthesized?

2,4,6-Trimethylbenzenesulfonamide is typically synthesized by reacting 2,4,6-trimethylbenzenesulfony...

Compound Q&A

What industries use 2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2)?

2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2)?

When handling 2,4,6-Trimethylbenzenesulfonamide (CAS: 4543-58-2), it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...