Compound Q&A

What precautions should be taken when handling (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

Answer

(5-Isopropoxy-3-pyridinyl)boronic acid
When handling (5-Isopropoxy-3-pyridinyl)boronic acid, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety glasses. Work in a well-ventilated area or fume hood to minimize inhalation risks. Follow standard laboratory safety protocols and consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name (5-Isopropoxy-3-pyridinyl)boronic acid
Molecular Formula C8H12BNO3
Molecular Weight 181 g/mol
SMILES B(C1=CC(=CN=C1)OC(C)C)(O)O
InChIKey XQHUPBAXLPBXOT-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

(5-Isopropoxy-3-pyridinyl)boronic acid has a crystalline form and a molecular weight of approximatel...

Compound Q&A

How is (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2) typically synthesized?

(5-Isopropoxy-3-pyridinyl)boronic acid is typically synthesized via a protected pyridine route, wher...

Compound Q&A

What industries use (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

(5-Isopropoxy-3-pyridinyl)boronic acid is widely used in pharmaceuticals for drug synthesis, particu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...