Compound Q&A

What are the physical and chemical properties of (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

Answer

(5-Isopropoxy-3-pyridinyl)boronic acid
(5-Isopropoxy-3-pyridinyl)boronic acid has a crystalline form and a molecular weight of approximately 245.25 g/mol. It is slightly soluble in water and has good solubility in organic solvents. This compound is known for its reactivity in boronate ester formation and is stable under normal storage conditions.

About

English Name (5-Isopropoxy-3-pyridinyl)boronic acid
Molecular Formula C8H12BNO3
Molecular Weight 181 g/mol
SMILES B(C1=CC(=CN=C1)OC(C)C)(O)O
InChIKey XQHUPBAXLPBXOT-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2) typically synthesized?

(5-Isopropoxy-3-pyridinyl)boronic acid is typically synthesized via a protected pyridine route, wher...

Compound Q&A

What industries use (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

(5-Isopropoxy-3-pyridinyl)boronic acid is widely used in pharmaceuticals for drug synthesis, particu...

Compound Q&A

What precautions should be taken when handling (5-Isopropoxy-3-pyridinyl)boronic acid (CAS: 850991-41-2)?

When handling (5-Isopropoxy-3-pyridinyl)boronic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...