Compound Q&A

What industries use trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

Answer

trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride
This compound is primarily used in the pharmaceutical industry for the development of novel drugs. It may also find applications in polymer chemistry for the synthesis of advanced materials and in sensor technology for detecting specific compounds.

About

English Name trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride
Molecular Formula C25H25ClFNO3
Molecular Weight 441.93 g/mol
SMILES C1CNCC(C1C2=CC=C(C=C2)C3=CC=C(C=C3)F)COC4=CC5=C(C=C4)OCO5.Cl
InChIKey LXCDAUDXYHUOFQ-KFWGXXPESA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

The compound is a white crystalline solid with a molecular weight of approximately 501.6 g/mol. It h...

Compound Q&A

How is trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2) typically synthesized?

This compound is typically synthesized by a multistep process involving coupling of benzo[1,3]dioxol...

Compound Q&A

What precautions should be taken when handling trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

Handle with appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...