Compound Q&A

How is trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2) typically synthesized?

Answer

trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride
This compound is typically synthesized by a multistep process involving coupling of benzo[1,3]dioxol-5-yl methanol with 4'-fluoro-biphenyl, followed by piperidine attachment and hydrochloride formation. The specific reaction conditions and catalysts used can vary, but the overall yield is good.

About

English Name trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride
Molecular Formula C25H25ClFNO3
Molecular Weight 441.93 g/mol
SMILES C1CNCC(C1C2=CC=C(C=C2)C3=CC=C(C=C3)F)COC4=CC5=C(C=C4)OCO5.Cl
InChIKey LXCDAUDXYHUOFQ-KFWGXXPESA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

The compound is a white crystalline solid with a molecular weight of approximately 501.6 g/mol. It h...

Compound Q&A

What industries use trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What precautions should be taken when handling trans-3-(Benzo[1,3]dioxol-5-yloxymethyl)-4-(4'-fluoro-biphenyl-4-yl)-piperidine hydrochloride (CAS: 1217655-87-2)?

Handle with appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...