Compound Q&A

What industries use Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

Answer

Methyl 2,3-difluoro-4-methylbenzoate
Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is used in various industries, including pharmaceuticals for intermediate synthesis, polymer science for monomer production, and sensors for detecting specific chemicals. It also finds applications in the synthesis of semiconductors and as a reagent in analytical chemistry.

About

English Name Methyl 2,3-difluoro-4-methylbenzoate
Molecular Formula C9H8F2O2
Molecular Weight 186.16 g/mol
SMILES CC1=C(C(=C(C=C1)C(=O)OC)F)F
InChIKey YCFUSIDKEYANIW-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is a crystalline solid with a molecular weig...

Compound Q&A

How is Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) typically synthesized?

Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is commonly synthesized via the esterificati...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

When handling Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...