Compound Q&A

How is Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) typically synthesized?

Answer

Methyl 2,3-difluoro-4-methylbenzoate
Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is commonly synthesized via the esterification of 2,3-difluoro-4-methylbenzoic acid with methanol. The synthesis involves heating the acid and methanol in the presence of an acid catalyst like sulfuric acid. The yield is typically around 85-90%, and the reaction is conducted in a fume hood due to the generation of volatile acids.

About

English Name Methyl 2,3-difluoro-4-methylbenzoate
Molecular Formula C9H8F2O2
Molecular Weight 186.16 g/mol
SMILES CC1=C(C(=C(C=C1)C(=O)OC)F)F
InChIKey YCFUSIDKEYANIW-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9) is used in various industries, including pha...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9)?

When handling Methyl 2,3-difluoro-4-methylbenzoate (CAS: 773874-06-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...