Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate (CAS: 5676-48-2)?

Answer

2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate
2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate is a crystalline solid with a molecular weight of approximately 224.12 g/mol. It is slightly soluble in water and less soluble in organic solvents. This compound is known for its oxidative properties and is generally stable under normal conditions, but it can react with reducing agents. It has a melting point of 225-227°C and is a dihydrate, meaning it contains two water molecules per molecule.

About

CAS No 5676-48-2
English Name 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate
Molecular Formula C6H8O8
Molecular Weight 208.12199999999999 g/mol
SMILES C1(=C(C(=O)C(=C(C1=O)O)O)O)O.O.O
InChIKey PTIMJXRLFTZAOV-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate (CAS: 5676-48-2) typically synthesized?

2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate is commonly synthesized by the oxidation of 2,3,5,6-...

Compound Q&A

What industries use 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate (CAS: 5676-48-2)?

2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate (CAS: 5676-48-2)?

When handling 2,3,5,6-Tetrahydroxy-1,4-benzoquinone dihydrate, it is important to wear appropriate p...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...