Compound Q&A

What are the physical and chemical properties of Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1)?

Answer

Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate
Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1) is a crystalline solid with a molecular weight of approximately 216.26 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is relatively stable but can react with strong bases. It is typically used in the synthesis of other compounds and pharmaceuticals.

About

English Name Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate
Molecular Formula C10H16N2O2
Molecular Weight 196.25 g/mol
SMILES CCCC1=NN(C(=C1)C(=O)OCC)C
InChIKey ZPSRHLWRTVNGSM-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1) typically synthesized?

Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1) is synthesized through a multi-...

Compound Q&A

What industries use Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1)?

Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1)?

When handling Ethyl 1-methyl-3-propyl-1H-pyrazole-5-carboxylate (CAS: 133261-07-1), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...