Compound Q&A

What are the physical and chemical properties of Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6)?

Answer

Fmoc-a-Me-Asp(OtBu)-OH
Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6) is a solid, crystalline compound with a molecular weight of approximately 408.4 g/mol. It has limited solubility in water and is more soluble in organic solvents like methanol and dimethylformamide. This compound exhibits limited reactivity in aqueous environments but is stable under dry and anhydrous conditions. It is often used in peptide synthesis due to its high purity and reactivity.

About

English Name Fmoc-a-Me-Asp(OtBu)-OH
Molecular Formula C24H27NO6
Molecular Weight 425.48 g/mol
SMILES O=C(N[C@](C(=O)O)(CC(=O)OC(C)(C)C)C)OCC1c2ccccc2c2c1cccc2
InChIKey STBMKQNEFSJOCS-DEOSSOPVSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6) typically synthesized?

Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6) is synthesized through the coupling of a protected amino ...

Compound Q&A

What industries use Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6)?

Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6) is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6)?

When handling Fmoc-a-Me-Asp(OtBu)-OH (CAS: 1072845-47-6), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...