Compound Q&A

What are the physical and chemical properties of (R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate (CAS: 82542-42-5)?

Answer

(R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate
This compound is a colorless solid with a molecular weight of approximately 416.49 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and ethanol. It is known for its reactivity in various chemical transformations, particularly in organic synthesis.

About

CAS No 82542-42-5
English Name (R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate
Molecular Formula C19H32O4Si
Molecular Weight 352.55 g/mol
SMILES CC(C)(C)[Si](C)(C)OC1CC(=O)C(=C1)CC=CCCCC(=O)OC
InChIKey KMZNNYCERSPGGM-GQSKFBFOSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is (R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate (CAS: 82542-42-5) typically synthesized?

This compound can be synthesized via a multi-step process involving alkylation, silylation, and ring...

Compound Q&A

What industries use (R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate (CAS: 82542-42-5)?

This compound is primarily used in the pharmaceutical and chemical industries for intermediates in m...

Compound Q&A

What precautions should be taken when handling (R,Z)-Methyl 7-(3-((tert-butyldimethylsilyl)-oxy)-5-oxocyclopent-1-en-1-yl)hept-5-enoate (CAS: 82542-42-5)?

Handling this compound requires appropriate personal protective equipment (PPE) such as gloves, gogg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...