Compound Q&A

What are the physical and chemical properties of 2-chloro-9-methyl-purin-6-amine (CAS: 7013-21-0)?

Answer

2-chloro-9-methyl-purin-6-amine
2-Chloro-9-methyl-purin-6-amine (CAS: 7013-21-0) is a white to off-white crystalline solid. It has a molecular weight of approximately 266.04 g/mol. The compound is sparingly soluble in water and more soluble in organic solvents like methanol and ethanol. It demonstrates good stability under normal conditions but is sensitive to strong acids and bases. It does not react readily with common reagents but can undergo nucleophilic substitution reactions.

About

CAS No 7013-21-0
English Name 2-chloro-9-methyl-purin-6-amine
Molecular Formula C6H6ClN5
Molecular Weight 183.6 g/mol
SMILES CN1C=NC2=C(N=C(N=C21)Cl)N
InChIKey XBMKMJLOOAHOKH-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is 2-chloro-9-methyl-purin-6-amine (CAS: 7013-21-0) typically synthesized?

2-Chloro-9-methyl-purin-6-amine is typically synthesized via the alkylation of 6-amino-9-chloropurin...

Compound Q&A

What industries use 2-chloro-9-methyl-purin-6-amine (CAS: 7013-21-0)?

2-Chloro-9-methyl-purin-6-amine (CAS: 7013-21-0) is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 2-chloro-9-methyl-purin-6-amine (CAS: 7013-21-0)?

When handling 2-chloro-9-methyl-purin-6-amine (CAS: 7013-21-0), it is crucial to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...