Compound Q&A

What precautions should be taken when handling Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

Answer

Platinum(2+) chloride 1,10-phenanthroline (1:2:1)
When handling Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6), ensure the use of personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood. In case of spill, dispose of according to safety data sheet (SDS) guidelines. Always consult the SDS for specific handling instructions.

About

CAS No 18432-95-6
English Name Platinum(2+) chloride 1,10-phenanthroline (1:2:1)
Molecular Formula C12H8Cl2N2Pt
Molecular Weight 446.2 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Pt]Cl
InChIKey VONLGUDYJIAGQI-UHFFFAOYSA-L
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is a crystalline compound with a...

Compound Q&A

How is Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) typically synthesized?

Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is synthesized by reacting plati...

Compound Q&A

What industries use Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is used in various industries, i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...