Compound Q&A

What industries use Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

Answer

Platinum(2+) chloride 1,10-phenanthroline (1:2:1)
Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is used in various industries, including pharmaceuticals for drug synthesis, polymers for catalyst applications, sensors for analytical chemistry, and semiconductors for electronic device fabrication. Its versatile reactivity makes it valuable in these fields.

About

CAS No 18432-95-6
English Name Platinum(2+) chloride 1,10-phenanthroline (1:2:1)
Molecular Formula C12H8Cl2N2Pt
Molecular Weight 446.2 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Pt]Cl
InChIKey VONLGUDYJIAGQI-UHFFFAOYSA-L
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is a crystalline compound with a...

Compound Q&A

How is Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) typically synthesized?

Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6) is synthesized by reacting plati...

Compound Q&A

What precautions should be taken when handling Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6)?

When handling Platinum(2+) chloride 1,10-phenanthroline (1:2:1) (CAS: 18432-95-6), ensure the use of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...