Compound Q&A

How is 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6) typically synthesized?

Answer

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid
1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is typically synthesized via a multi-step process involving the condensation of 2-methylbenzimidazole with benzylic alcohol, followed by the introduction of a hydroxyl group via a nucleophilic substitution reaction. The process requires careful control of reaction conditions to achieve high yields and selectivity.

About

English Name 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid
Molecular Formula C16H14N2O3
Molecular Weight 282.3 g/mol
SMILES CC1=NC2C(=CC(=CC=2O)C(O)=O)N1CC1C=CC=CC=1
InChIKey LRVLIEIZJOKBQA-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is a white to off-white crystalline s...

Compound Q&A

What industries use 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is used in various industries, includ...

Compound Q&A

What precautions should be taken when handling 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

When handling 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid, it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...