Compound Q&A

What are the physical and chemical properties of 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

Answer

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid
1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 332.3 g/mol. It has a high solubility in organic solvents like methanol and ethanol but is poorly soluble in water. The compound is moderately reactive, particularly towards nucleophiles and reducing agents. It exhibits good absorption properties, which is beneficial for its use in sensor applications.

About

English Name 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid
Molecular Formula C16H14N2O3
Molecular Weight 282.3 g/mol
SMILES CC1=NC2C(=CC(=CC=2O)C(O)=O)N1CC1C=CC=CC=1
InChIKey LRVLIEIZJOKBQA-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6) typically synthesized?

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is typically synthesized via a multi-...

Compound Q&A

What industries use 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid is used in various industries, includ...

Compound Q&A

What precautions should be taken when handling 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid (CAS: 1640981-19-6)?

When handling 1-Benzyl-4-hydroxy-2-methyl-1H-benzimidazole-6-carboxylic acid, it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...