Compound Q&A

What industries use 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS: 71215-81-1)?

Answer

5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide
5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide is primarily used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also utilized in the production of sensors, semiconductors, and as an intermediate in the development of new materials. Its stability and reactivity make it a valuable compound in various chemical processes.

About

CAS No 71215-81-1
English Name 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide
Molecular Formula C14H15ClN2O2S
Molecular Weight 310.81 g/mol
SMILES CC1=CC(=C(C=C1)NS(=O)(=O)C2=C(C=CC(=C2)N)Cl)C
InChIKey SOWYLSRVTBKKJE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS: 71215-81-1)?

5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide is a crystalline compound with a molecular...

Compound Q&A

How is 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS: 71215-81-1) typically synthesized?

5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide is typically synthesized via a multi-step ...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS: 71215-81-1)?

When handling 5-Amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...