Compound Q&A

What are the physical and chemical properties of Ciluprevir (CAS: 300832-84-2)?

Answer

Ciluprevir
Ciluprevir is a white or off-white crystalline powder with a molecular weight of approximately 485.47 g/mol. It has a solubility of about 20 mg/mL in water and is practically insoluble in organic solvents. Chemically, it is stable under normal conditions but can degrade under acidic or basic conditions. It exhibits good reactivity towards nucleophilic substitution reactions.

About

English Name Ciluprevir
Molecular Formula C40H50N6O8S
Molecular Weight 774.9 g/mol
SMILES CC(C)NC1=NC(=CS1)C2=NC3=C(C=CC(=C3)OC)C(=C2)OC4CC5C(=O)NC6(CC6C=CCCCCCC(C(=O)N5C4)NC(=O)OC7CCCC7)C(=O)O
InChIKey PJZPDFUUXKKDNB-KNINVFKUSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is Ciluprevir (CAS: 300832-84-2) typically synthesized?

Ciluprevir is synthesized via a multi-step process involving Friedel-Crafts alkylation and subsequen...

Compound Q&A

What industries use Ciluprevir (CAS: 300832-84-2)?

Ciluprevir is primarily used in the pharmaceutical industry. It is an antiviral drug used in the tre...

Compound Q&A

What precautions should be taken when handling Ciluprevir (CAS: 300832-84-2)?

When handling Ciluprevir, it is essential to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...