Compound Q&A

What precautions should be taken when handling Desmethyl Lacosamide (CAS: 175481-38-6)?

Answer

Desmethyl Lacosamide
When handling Desmethyl Lacosamide, it is important to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. It should be stored in a cool, dry place away from direct sunlight. In case of spillage, it should be cleaned up according to standard procedures and the material safety data sheet (MSDS) should be consulted for specific instructions. Always ensure proper ventilation and use a fume hood when handling the compound.

About

English Name Desmethyl Lacosamide
Molecular Formula C12H16N2O3
Molecular Weight 236.27 g/mol
SMILES CC(=O)NC(CO)C(=O)NCC1=CC=CC=C1
InChIKey XRKSCJLQKGLSKU-LLVKDONJSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desmethyl Lacosamide (CAS: 175481-38-6)?

Desmethyl Lacosamide is a crystalline white solid with a molecular weight of approximately 245.25 g/...

Compound Q&A

How is Desmethyl Lacosamide (CAS: 175481-38-6) typically synthesized?

Desmethyl Lacosamide is typically synthesized through a series of reactions including amide formatio...

Compound Q&A

What industries use Desmethyl Lacosamide (CAS: 175481-38-6)?

Desmethyl Lacosamide is primarily used in the pharmaceutical industry for its anti-epileptic propert...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...