Compound Q&A

What industries use Desmethyl Lacosamide (CAS: 175481-38-6)?

Answer

Desmethyl Lacosamide
Desmethyl Lacosamide is primarily used in the pharmaceutical industry for its anti-epileptic properties. It is also used in the development of novel drugs and as a research tool in the study of sodium channels.

About

English Name Desmethyl Lacosamide
Molecular Formula C12H16N2O3
Molecular Weight 236.2670 g/mol
SMILES CC(=O)NC(CO)C(=O)NCC1=CC=CC=C1
InChIKey XRKSCJLQKGLSKU-LLVKDONJSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desmethyl Lacosamide (CAS: 175481-38-6)?

Desmethyl Lacosamide is a crystalline white solid with a molecular weight of approximately 245.25 g/...

Compound Q&A

How is Desmethyl Lacosamide (CAS: 175481-38-6) typically synthesized?

Desmethyl Lacosamide is typically synthesized through a series of reactions including amide formatio...

Compound Q&A

What precautions should be taken when handling Desmethyl Lacosamide (CAS: 175481-38-6)?

When handling Desmethyl Lacosamide, it is important to wear appropriate personal protective equipmen...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...