Compound Q&A

How is (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid (CAS: 116380-66-6) typically synthesized?

Answer

(3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid
This compound is typically synthesized via a multi-step process involving saponification of cholesterol, followed by enzymatic or chemical transformations. Common catalysts include alkaline earth metal hydroxides and organometallic compounds. The synthesis yields a high purity product with good selectivity and acceptable yield.

About

English Name (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid
Molecular Formula C24H36D4O5
Molecular Weight 412.6 g/mol
SMILES CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C
InChIKey BHQCQFFYRZLCQQ-YFEOEUIKSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid (CAS: 116380-66-6)?

The compound (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid is a...

Compound Q&A

What industries use (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid (CAS: 116380-66-6)?

This compound is used in the pharmaceutical industry for producing bile acid analogs, which are impo...

Compound Q&A

What precautions should be taken when handling (3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy(2,2,4,4-~2~H_4_)cholan-24-oic acid (CAS: 116380-66-6)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...