Compound Q&A

How is 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2) typically synthesized?

Answer

5-Chlorosaligenyl-N,N-diisopropylphosphoramidite
5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2) is typically synthesized via a multi-step process involving the reaction of chloroacetyl chloride with saligenin, followed by the addition of diisopropyl phosphorochloridite. The reaction is catalyzed by a base such as triethylamine, and the product is isolated through recrystallization to obtain the crystalline form.

About

English Name 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite
Molecular Formula C13H19ClNO2P
Molecular Weight 287.72 g/mol
SMILES Clc1ccc2c(c1)COP(O2)N(C(C)C)C(C)C
InChIKey ZJPWJYRCWIYHMH-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2)?

5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2) is a white crystalline solid wi...

Compound Q&A

What industries use 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2)?

5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2)?

When handling 5-Chlorosaligenyl-N,N-diisopropylphosphoramidite (CAS: 1620086-77-2), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...