Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate (CAS: 877859-58-0)?

Answer

2-Methyl-2-propanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate is a colorless to white crystalline solid with a molecular weight of approximately 288.39 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and ethanol. The compound exhibits moderate reactivity, showing basic properties due to the presence of the amino group and piperidine ring, and is stable under normal conditions but should be stored in a dry, fume hood to prevent moisture absorption.

About

English Name 2-Methyl-2-propanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate
Molecular Formula C14H26N2O2
Molecular Weight 254.37 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)CNC2CC2
InChIKey CZXMVDICWYFHTA-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate (CAS: 877859-58-0) typically synthesized?

2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate can be synthesized by reacti...

Compound Q&A

What industries use 2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate (CAS: 877859-58-0)?

2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate finds applications in pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate (CAS: 877859-58-0)?

When handling 2-Methyl-2-proanyl 4-[(cyclopropylamino)methyl]-1-piperidinecarboxylate, it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...