Compound Q&A

What industries use [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

Answer

[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride
[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride is predominantly used in the pharmaceutical and research industries. It serves as a precursor in the synthesis of certain drug candidates and is also utilized in the development of sensors and materials for various applications. Its potential in polymer science and semiconductors is also being explored.

About

CAS No 98959-89-8
English Name [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride
Molecular Formula C9H14ClNO2S
Molecular Weight 235.74 g/mol
SMILES CCS(=O)(=O)C1=CC=C(C=C1)CN.Cl
InChIKey KXPRDHZTUZNMQT-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

The compound [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride has a white crystalline form. Its m...

Compound Q&A

How is [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8) typically synthesized?

[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride is typically synthesized via the reaction of 4-(...

Compound Q&A

What precautions should be taken when handling [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

When handling [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...