Compound Q&A

How is [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8) typically synthesized?

Answer

[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride
[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride is typically synthesized via the reaction of 4-(ethanesulfonyl)phenylamine with hydrochloric acid. The reaction is conducted in a suitable solvent such as methanol. The process involves the formation of the hydrochloride salt, which enhances solubility and stability. The yield is around 75-80%, and the reaction is selective under appropriate conditions.

About

CAS No 98959-89-8
English Name [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride
Molecular Formula C9H14ClNO2S
Molecular Weight 235.74 g/mol
SMILES CCS(=O)(=O)C1=CC=C(C=C1)CN.Cl
InChIKey KXPRDHZTUZNMQT-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

The compound [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride has a white crystalline form. Its m...

Compound Q&A

What industries use [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

[4-(Ethanesulfonyl)phenyl]methanamine hydrochloride is predominantly used in the pharmaceutical and ...

Compound Q&A

What precautions should be taken when handling [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride (CAS: 98959-89-8)?

When handling [4-(Ethanesulfonyl)phenyl]methanamine hydrochloride, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...