Compound Q&A

What precautions should be taken when handling 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

Answer

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid
When handling 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0), ensure the use of appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work in a well-ventilated area or a fume hood. Spills should be handled carefully, using absorbent materials and disposing of waste according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid
Molecular Formula C21H42O12
Molecular Weight 486.56 g/mol
SMILES COCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O
InChIKey XVVLEAQJQOTYFV-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) is a crystalline soli...

Compound Q&A

How is 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) typically synthesized?

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid can be synthesized through multi-step re...

Compound Q&A

What industries use 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) is utilized in the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...