Compound Q&A

What are the physical and chemical properties of 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

Answer

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid
2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) is a crystalline solid with a molecular weight of approximately 728.29 g/mol. It is poorly soluble in water but slightly soluble in organic solvents. Chemically, it is a linear fatty acid with a high reactivity due to its carboxylic acid group, making it prone to esterification and other acid-base reactions.

About

English Name 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid
Molecular Formula C21H42O12
Molecular Weight 486.56 g/mol
SMILES COCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O
InChIKey XVVLEAQJQOTYFV-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) typically synthesized?

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid can be synthesized through multi-step re...

Compound Q&A

What industries use 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0) is utilized in the ph...

Compound Q&A

What precautions should be taken when handling 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0)?

When handling 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontan-31-oic acid (CAS: 405518-55-0), ensure...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...