Compound Q&A

How is Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2) typically synthesized?

Answer

Methyl 4-acetyl-2-hydroxybenzoate
Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2) is typically synthesized via esterification of acetic anhydride and 4-hydroxybenzoic acid. The reaction is usually conducted in the presence of a catalyst such as sulfuric acid, and yields up to 90% of the desired product. The product can be purified by recrystallization from ethanol.

About

CAS No 27475-11-2
English Name Methyl 4-acetyl-2-hydroxybenzoate
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)C(=O)OC)O
InChIKey ATVFLHHFBWGFDZ-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2)?

Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2) is a white to pale yellow crystalline solid with...

Compound Q&A

What industries use Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2)?

Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2) is used in the pharmaceutical industry for synth...

Compound Q&A

What precautions should be taken when handling Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2)?

When handling Methyl 4-acetyl-2-hydroxybenzoate (CAS: 27475-11-2), ensure the use of appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...