Compound Q&A

What industries use (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 23214-66-6)?

Answer

(2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate
(2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of drugs that require specific functional groups. It is also utilized in the polymer industry as a monomer or as a modifier to improve properties of polymers. Additionally, it has applications in sensor technology and semiconductor manufacturing due to its chemical reactivity and functional groups.

About

CAS No 23214-66-6
English Name (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate
Molecular Formula C17H20O5S
Molecular Weight 336.41 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC(COCC2=CC=CC=C2)O
InChIKey HBMUWOSOGHUWSS-MRXNPFEDSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 23214-66-6)?

(2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate has a crystalline form and a molecular w...

Compound Q&A

How is (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 23214-66-6) typically synthesized?

(2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate is typically synthesized via a multistep...

Compound Q&A

What precautions should be taken when handling (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate (CAS: 23214-66-6)?

When handling (2R)-3-(Benzyloxy)-2-hydroxypropyl 4-methylbenzenesulfonate, it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...