Compound Q&A

How is Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7) typically synthesized?

Answer

Triamcinolone Acetonide Impurity 3
Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7) is synthesized through a series of reactions starting from triamcinolone acetonide. Commonly, it involves hydrogenation, oxidation, and/or reduction steps. The exact methodology can vary depending on the desired purity and yield, but typically, the synthesis involves the use of catalysts like palladium on carbon and various oxidants or reductants to achieve the desired impurity profile.

About

CAS No 5541-37-7
English Name Triamcinolone Acetonide Impurity 3
Molecular Formula C24H30O5
Molecular Weight 398.5 g/mol
SMILES CC1(C)O[C@@H]2CC3C4CCC5=CC(=O)C=C[C@]5(C)C4=CC[C@]3(C)[C@@]2(O1)C(=O)CO
InChIKey XTAIWNCAVBJJDD-OQYXIQFSSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7)?

Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7) is a white to off-white crystalline powder. It h...

Compound Q&A

What industries use Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7)?

Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7)?

When handling Triamcinolone Acetonide Impurity 3 (CAS: 5541-37-7), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...