Compound Q&A

What precautions should be taken when handling 4-(Trimethylsilyl)benzaldehyde (CAS: 2199-32-8)?

Answer

4-(Trimethylsilyl)benzaldehyde
When handling 4-(Trimethylsilyl)benzaldehyde, ensure proper ventilation and use in a fume hood. Wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Store the compound in a well-ventilated and dry area away from heat sources. In case of a spill, handle it carefully and follow proper waste disposal procedures. Refer to the Safety Data Sheet (SDS) for detailed information on handling and storage.

About

CAS No 2199-32-8
English Name 4-(Trimethylsilyl)benzaldehyde
Molecular Formula C10H14OSi
Molecular Weight 178.31 g/mol
SMILES C[Si](C)(C)C1=CC=C(C=C1)C=O
InChIKey BPCNVZGALJUWSO-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Trimethylsilyl)benzaldehyde (CAS: 2199-32-8)?

4-(Trimethylsilyl)benzaldehyde is a crystalline compound with a molecular weight of approximately 22...

Compound Q&A

How is 4-(Trimethylsilyl)benzaldehyde (CAS: 2199-32-8) typically synthesized?

4-(Trimethylsilyl)benzaldehyde is typically synthesized through the reaction of benzaldehyde with tr...

Compound Q&A

What industries use 4-(Trimethylsilyl)benzaldehyde (CAS: 2199-32-8)?

4-(Trimethylsilyl)benzaldehyde is utilized in the pharmaceutical and polymer industries. It serves a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...