Compound Q&A

What industries use 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

Answer

5,6-Dichloro-3-pyridinesulfonyl chloride
5,6-Dichloro-3-pyridinesulfonyl chloride is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and other chemical compounds. Due to its reactivity, it is also utilized in the preparation of functionalized polymers and in the development of sensors and semiconductors.

About

CAS No 98121-40-5
English Name 5,6-Dichloro-3-pyridinesulfonyl chloride
Molecular Formula C5H2Cl3NO2S
Molecular Weight 246.5 g/mol
SMILES C1=C(C=NC(=C1Cl)Cl)S(=O)(=O)Cl
InChIKey AXIWIKRWIWIPGT-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

5,6-Dichloro-3-pyridinesulfonyl chloride is a white to off-white crystalline solid with a molecular ...

Compound Q&A

How is 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5) typically synthesized?

5,6-Dichloro-3-pyridinesulfonyl chloride is synthesized by the chlorosulfonation of 3-pyridinesulfon...

Compound Q&A

What precautions should be taken when handling 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

Handling 5,6-Dichloro-3-pyridinesulfonyl chloride requires appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...