Compound Q&A

What are the physical and chemical properties of 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

Answer

5,6-Dichloro-3-pyridinesulfonyl chloride
5,6-Dichloro-3-pyridinesulfonyl chloride is a white to off-white crystalline solid with a molecular weight of approximately 257.05 g/mol. It is slightly soluble in water but readily soluble in organic solvents such as methanol and acetone. This compound is highly reactive, particularly towards nucleophiles and can undergo sulfonation reactions. It has a pKa of approximately 2.5, indicating its acidic nature.

About

CAS No 98121-40-5
English Name 5,6-Dichloro-3-pyridinesulfonyl chloride
Molecular Formula C5H2Cl3NO2S
Molecular Weight 246.5 g/mol
SMILES C1=C(C=NC(=C1Cl)Cl)S(=O)(=O)Cl
InChIKey AXIWIKRWIWIPGT-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5) typically synthesized?

5,6-Dichloro-3-pyridinesulfonyl chloride is synthesized by the chlorosulfonation of 3-pyridinesulfon...

Compound Q&A

What industries use 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

5,6-Dichloro-3-pyridinesulfonyl chloride is primarily used in the pharmaceutical and chemical indust...

Compound Q&A

What precautions should be taken when handling 5,6-Dichloro-3-pyridinesulfonyl chloride (CAS: 98121-40-5)?

Handling 5,6-Dichloro-3-pyridinesulfonyl chloride requires appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...