Compound Q&A

What are the physical and chemical properties of Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6)?

Answer

Triphenyl(propyl)phosphonium iodide
Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6) is a crystalline solid with a high molecular weight. It is poorly soluble in water but soluble in organic solvents like benzene and chloroform. This compound is reactive towards nucleophiles and can act as a Lewis acid. It has a low vapor pressure and is stable under normal conditions.

About

CAS No 14350-50-6
English Name Triphenyl(propyl)phosphonium iodide
Molecular Formula C21H22IP
Molecular Weight 432.3 g/mol
SMILES CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-]
InChIKey MPNQDJZRGAOBPW-UHFFFAOYSA-M
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6) typically synthesized?

Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6) is typically synthesized by reacting triphenyl...

Compound Q&A

What industries use Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6)?

Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6)?

When handling Triphenyl(propyl)phosphonium iodide (CAS: 14350-50-6), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...