Compound Q&A

What industries use (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

Answer

(E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid
This compound has applications in the pharmaceutical industry, particularly in the development of new drugs. It is also used in the production of polymers, where its properties can enhance the performance of certain materials. Additionally, it is utilized in sensor technology for detecting specific chemical compounds, and in semiconductor manufacturing for its unique reactivity characteristics.

About

English Name (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid
Molecular Formula C22H34O4
Molecular Weight 362.5 g/mol
SMILES CCCCC(C)CC(C=CC1C=CC(=O)C1CCCCC=CC(=O)O)O
InChIKey CNNBNXXMENIOCQ-RKZGRAQHSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

The compound has a crystalline form and a molecular weight of approximately 428.57 g/mol. Its solubi...

Compound Q&A

How is (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4) typically synthesized?

This compound can be synthesized using a Wittig reaction, where an alkyl phosphonate reacts with a k...

Compound Q&A

What precautions should be taken when handling (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

When handling this compound, it is important to use personal protective equipment (PPE), including g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...