Compound Q&A

What are the physical and chemical properties of (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

Answer

(E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid
The compound has a crystalline form and a molecular weight of approximately 428.57 g/mol. Its solubility in water is low, with an estimated solubility of about 0.1 g/L at 25°C. Chemically, it is reactive towards nucleophiles and can undergo hydrolysis. It is sensitive to strong bases and acids, making it susceptible to degradation under harsh conditions.

About

English Name (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid
Molecular Formula C22H34O4
Molecular Weight 362.5 g/mol
SMILES CCCCC(C)CC(C=CC1C=CC(=O)C1CCCCC=CC(=O)O)O
InChIKey CNNBNXXMENIOCQ-RKZGRAQHSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

How is (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4) typically synthesized?

This compound can be synthesized using a Wittig reaction, where an alkyl phosphonate reacts with a k...

Compound Q&A

What industries use (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

This compound has applications in the pharmaceutical industry, particularly in the development of ne...

Compound Q&A

What precautions should be taken when handling (E)-7-[2-[(E)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS: 853998-94-4)?

When handling this compound, it is important to use personal protective equipment (PPE), including g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...