Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

Answer

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride
When handling 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride, it is crucial to use appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Refer to the Safety Data Sheet (SDS) for detailed instructions on handling, storage, and disposal of this compound.

About

English Name 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride
Molecular Formula C6H2Cl3NO4S
Molecular Weight 290.51 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl)Cl
InChIKey KMRQWMSLMFLCKC-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5) typically synthesized?

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride is typically synthesized through a multi-step proces...

Compound Q&A

What industries use 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride finds applications in various industries, particular...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...