Compound Q&A

What industries use 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

Answer

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride
2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride finds applications in various industries, particularly in the pharmaceutical sector for the synthesis of complex organic compounds. It is also used in the production of certain dyes and pigments, as a reagent in analytical chemistry, and in the development of sensors for detecting specific chemicals.

About

English Name 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride
Molecular Formula C6H2Cl3NO4S
Molecular Weight 290.51 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl)Cl
InChIKey KMRQWMSLMFLCKC-UHFFFAOYSA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5) typically synthesized?

2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride is typically synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride (CAS: 276702-53-5)?

When handling 2,6-Dichloro-3-nitrobenzene-1-sulfonyl chloride, it is crucial to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...