Compound Q&A

What industries use 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

Answer

2-(Diisopropylamino)ethyl methacrylate
2-(Diisopropylamino)ethyl methacrylate finds applications in various industries. It is widely used in the pharmaceutical sector for the synthesis of drugs and intermediates. In the polymer industry, it serves as a monomer for the production of functional polymers. Additionally, it is utilized in the sensor and semiconductor industries for its unique chemical reactivity and solubility properties.

About

CAS No 16715-83-6
English Name 2-(Diisopropylamino)ethyl methacrylate
Molecular Formula C12H23NO2
Molecular Weight 213.32 g/mol
SMILES CC(C)N(CCOC(=O)C(=C)C)C(C)C
InChIKey SVYHMICYJHWXIN-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

2-(Diisopropylamino)ethyl methacrylate is a colorless to slightly amber liquid with a molecular weig...

Compound Q&A

How is 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6) typically synthesized?

2-(Diisopropylamino)ethyl methacrylate is typically synthesized via the reaction of methacryloyl chl...

Compound Q&A

What precautions should be taken when handling 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

When handling 2-(Diisopropylamino)ethyl methacrylate, appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...