Compound Q&A

What are the physical and chemical properties of 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

Answer

2-(Diisopropylamino)ethyl methacrylate
2-(Diisopropylamino)ethyl methacrylate is a colorless to slightly amber liquid with a molecular weight of approximately 256.5 g/mol. It has a moderate solubility in organic solvents such as methanol and ethanol. Chemically, it is reactive towards nucleophiles and electrophiles, making it useful in polymer synthesis and pharmaceutical applications. Its physical properties include a density of about 0.96 g/cm³ and a boiling point of around 175°C.

About

CAS No 16715-83-6
English Name 2-(Diisopropylamino)ethyl methacrylate
Molecular Formula C12H23NO2
Molecular Weight 213.32 g/mol
SMILES CC(C)N(CCOC(=O)C(=C)C)C(C)C
InChIKey SVYHMICYJHWXIN-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6) typically synthesized?

2-(Diisopropylamino)ethyl methacrylate is typically synthesized via the reaction of methacryloyl chl...

Compound Q&A

What industries use 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

2-(Diisopropylamino)ethyl methacrylate finds applications in various industries. It is widely used i...

Compound Q&A

What precautions should be taken when handling 2-(Diisopropylamino)ethyl methacrylate (CAS: 16715-83-6)?

When handling 2-(Diisopropylamino)ethyl methacrylate, appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...