Compound Q&A

What industries use Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

Answer

Ethyl 1-benzothiophene-2-carboxylate
Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis. It is also utilized in the preparation of polymers and as a component in sensors and semiconductors. Its applications are primarily in research and development due to its unique chemical properties.

About

CAS No 17890-55-0
English Name Ethyl 1-benzothiophene-2-carboxylate
Molecular Formula C11H10O2S
Molecular Weight 206.27 g/mol
SMILES CCOC(=O)C1=CC2=CC=CC=C2S1
InChIKey PSLMIXGNCNQQRY-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is a crystalline compound with a molecular we...

Compound Q&A

How is Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) typically synthesized?

Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is typically synthesized via the reaction of ...

Compound Q&A

What precautions should be taken when handling Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

When handling Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0), appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...