Compound Q&A

What are the physical and chemical properties of Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

Answer

Ethyl 1-benzothiophene-2-carboxylate
Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is a crystalline compound with a molecular weight of approximately 204.24 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is known for its reactivity in ester chemistry and can undergo hydrolysis under acidic conditions. It has a melting point of around 76-77°C.

About

CAS No 17890-55-0
English Name Ethyl 1-benzothiophene-2-carboxylate
Molecular Formula C11H10O2S
Molecular Weight 206.27 g/mol
SMILES CCOC(=O)C1=CC2=CC=CC=C2S1
InChIKey PSLMIXGNCNQQRY-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) typically synthesized?

Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is typically synthesized via the reaction of ...

Compound Q&A

What industries use Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0) is used in various industries, including phar...

Compound Q&A

What precautions should be taken when handling Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0)?

When handling Ethyl 1-benzothiophene-2-carboxylate (CAS: 17890-55-0), appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...