Compound Q&A

How is Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0) typically synthesized?

Answer

Diacenaphtho[1,2-j:1',2'-l]fluoranthene
Diacenaphtho[1,2-j:1',2'-l]fluoranthene is typically synthesized through the fluorination of anthracene using fluorine gas and a suitable catalyst. The reaction involves complex stoichiometry and high temperatures, with the use of anhydrous fluorine and a catalyst like copper hexafluorophosphate to achieve high selectivity and yield.

About

CAS No 191-48-0
English Name Diacenaphtho[1,2-j:1',2'-l]fluoranthene
Molecular Formula C36H18
Molecular Weight 450.54 g/mol
SMILES C1=CC2=C3C(=C1)C4=C5C6=CC=CC7=C6C(=CC=C7)C5=C8C9=CC=CC1=C9C(=CC=C1)C8=C4C3=CC=C2
InChIKey CUIWZLHUNCCYBL-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

Diacenaphtho[1,2-j:1',2'-l]fluoranthene is a solid compound with a high melting point. Its molecular...

Compound Q&A

What industries use Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

Diacenaphtho[1,2-j:1',2'-l]fluoranthene is used in the polymer industry for the development of advan...

Compound Q&A

What precautions should be taken when handling Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

When handling Diacenaphtho[1,2-j:1',2'-l]fluoranthene, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...