Compound Q&A

What are the physical and chemical properties of Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

Answer

Diacenaphtho[1,2-j:1',2'-l]fluoranthene
Diacenaphtho[1,2-j:1',2'-l]fluoranthene is a solid compound with a high melting point. Its molecular weight is approximately 354.3 g/mol. It has low solubility in water but is more soluble in organic solvents like chloroform and benzene. Chemically, it is relatively stable but can undergo photodegradation and oxidation reactions.

About

CAS No 191-48-0
English Name Diacenaphtho[1,2-j:1',2'-l]fluoranthene
Molecular Formula C36H18
Molecular Weight 450.54 g/mol
SMILES C1=CC2=C3C(=C1)C4=C5C6=CC=CC7=C6C(=CC=C7)C5=C8C9=CC=CC1=C9C(=CC=C1)C8=C4C3=CC=C2
InChIKey CUIWZLHUNCCYBL-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0) typically synthesized?

Diacenaphtho[1,2-j:1',2'-l]fluoranthene is typically synthesized through the fluorination of anthrac...

Compound Q&A

What industries use Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

Diacenaphtho[1,2-j:1',2'-l]fluoranthene is used in the polymer industry for the development of advan...

Compound Q&A

What precautions should be taken when handling Diacenaphtho[1,2-j:1',2'-l]fluoranthene (CAS: 191-48-0)?

When handling Diacenaphtho[1,2-j:1',2'-l]fluoranthene, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...