Compound Q&A

How is Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) typically synthesized?

Answer

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate
Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate is typically synthesized via a multistep process involving the reaction of phenyl isocyanate with 3-methoxy-1,2,4-thiadiazole. The synthesis requires careful control of reaction conditions, including temperature and the use of appropriate solvents. The final product is isolated and purified using techniques such as column chromatography and recrystallization.

About

English Name Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate
Molecular Formula C10H9N3O3S
Molecular Weight 251.27 g/mol
SMILES COc1nc(sn1)NC(=O)Oc2ccccc2
InChIKey WLFZBSSDZNVOJT-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) is a crystalline solid with a ...

Compound Q&A

What industries use Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

When handling Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...