Compound Q&A

What are the physical and chemical properties of Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

Answer

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate
Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) is a crystalline solid with a molecular weight of approximately 288.26 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is thermally stable and exhibits moderate reactivity towards nucleophiles and reducing agents.

About

English Name Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate
Molecular Formula C10H9N3O3S
Molecular Weight 251.27 g/mol
SMILES COc1nc(sn1)NC(=O)Oc2ccccc2
InChIKey WLFZBSSDZNVOJT-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) typically synthesized?

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate is typically synthesized via a multistep process i...

Compound Q&A

What industries use Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8)?

When handling Phenyl (3-methoxy-1,2,4-thiadiazol-5-yl)carbamate (CAS: 1445988-32-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...