Compound Q&A

What industries use Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

Answer

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate
Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a modifier and in the development of sensors for detecting specific chemical species. Additionally, it is used in the semiconductor industry for the production of photoresists.

About

CAS No 79247-72-6
English Name Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate
Molecular Formula C10H15NO2S
Molecular Weight 213.3 g/mol
SMILES CCOC(=O)C1=NC(=CS1)C(C)(C)C
InChIKey DCHMVIBNJJRJQS-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is a crystalline compound...

Compound Q&A

How is Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) typically synthesized?

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is typically synthesized ...

Compound Q&A

What precautions should be taken when handling Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

When handling Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6), laboratory...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...